| Name | 1,4-Dichloro-2-butanol |
| Synonyms | dichlorobutanol Dichlorobutanol 1,4-Dichlorobutanol 1,4-DICHLORO-2-BUTANOL 1,4-dichlorobutan-2-ol 1,4-Dichlorobutan-2-ol 1,4-Dichloro-2-butanol 2-Butanol, 1,4-dichloro- DI CHLORIDE NORMAL BUTANOL 1,4-dichloro-2-hydroxybutane |
| CAS | 2419-74-1 |
| EINECS | 219-339-2 |
| InChI | InChI=1/C4H8Cl2O/c5-2-1-4(7)3-6/h4,7H,1-3H2 |
| Molecular Formula | C4H8Cl2O |
| Molar Mass | 143.01 |
| Density | 1,29 g/cm3 |
| Boling Point | 90-95 °C(Press: 18 Torr) |
| Flash Point | 103.7°C |
| Vapor Presure | 0.0149mmHg at 25°C |
| Appearance | clear liquid |
| Color | Colorless to Light yellow |
| pKa | 13.58±0.20(Predicted) |
| Storage Condition | Room Temprature |
| Refractive Index | 1.4800 to 1.4830 |
| MDL | MFCD00191343 |
| Physical and Chemical Properties | Colorless transparent or light brown transparent liquid, content 80%-90%, boiling range 120.2-135 ℃(12.666-13.332kPa), refractive index 1.4882, soluble in ethanol, ether, benzene, insoluble in water. Visible light is easy to change color. Protected from light. |
colorless transparent or light brown transparent liquid. Soluble in ethanol, ether, benzene, insoluble in water. Refractive index 4882. The boiling range is 120.2~135 ℃(12. 666~13. 332kPa). Visible light is easy to change color. Protected from light.
1,2, 4-butanetriol reacted with hydrochloric acid at 100-110 ° C. To produce 1, 4-chloro-2-butanol, and the reaction solution was neutralized and distilled to obtain a finished product.
pharmaceutical intermediates.
| use | pharmaceutical intermediates. |
| production method | add 1,2, 4-butanetriol and glacial acetic acid into the reaction pot, stir and heat to about 100 ℃, pass in dry hydrogen chloride gas, and react at 90-110 ℃ for 0.5h. when a large amount of hydrogen chloride begins to appear in the tail gas, check the end point of the reaction and stop passing hydrogen chloride. After cooling, it was washed with saturated sodium carbonate solution, distilled under reduced pressure, and collected at 120-135 ℃(12.6-13.3kPa) to obtain oily 1, 4-dichloro-2-butanol. The yield is 50-60%. Raw material consumption quota: 1,2, 4-butanetriol 2965kg/t, glacial acetic acid 50kg/t, hydrochloric acid (industrial products) 7000kg/t. |